About (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane
(4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane (PubChem CID 143526405) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane.
Molecular Properties
| Compound Name | (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane |
| PubChem CID | 143526405 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane |
| SMILES | C/C=C\C=c1\[nH]c(C)n\c1=C\CC.CC |
| InChI | InChI=1S/C11H16N2.C2H6/c1-4-6-8-11-10(7-5-2)12-9(3)13-11;1-2/h4,6-8H,5H2,1-3H3,(H,12,13);1-2H3/b6-4-,10-7+,11-8+; |
| InChIKey | PDKQUXQLQFPMSV-LFCJICSYSA-N |
| XLogP | 2.29 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane?
The IUPAC name of (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane (CID 143526405) is (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane.
What is the SMILES notation for (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane?
The canonical SMILES for (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane is C/C=C\C=c1\[nH]c(C)n\c1=C\CC.CC.
What is the InChIKey of (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane?
The InChIKey is PDKQUXQLQFPMSV-LFCJICSYSA-N. The full InChI is InChI=1S/C11H16N2.C2H6/c1-4-6-8-11-10(7-5-2)12-9(3)13-11;1-2/h4,6-8H,5H2,1-3H3,(H,12,13);1-2H3/b6-4-,10-7+,11-8+;.
What are the key properties of (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane?
(4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane has a molecular weight of 206.33 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-5-[(Z)-but-2-enylidene]-2-methyl-4-propylidene-1H-imidazole;ethane is sourced from PubChem (CID 143526405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).