C19H36O4 — CID 143526504
formic acid;4-methyl-4-(4,5,5-trimethyl-4-propan-2-ylhex-1-en-2-yl)oxyoxane (PubChem CID 143526504) has the molecular formula C19H36O4 and a molecular weight of 328.49 g/mol. Its IUPAC name is formic acid;4-methyl-4-(4,5,5-trimethyl-4-propan-2-ylhex-1-en-2-yl)oxyoxane.
| Compound Name | formic acid;4-methyl-4-(4,5,5-trimethyl-4-propan-2-ylhex-1-en-2-yl)oxyoxane |
|---|---|
| PubChem CID | 143526504 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | formic acid;4-methyl-4-(4,5,5-trimethyl-4-propan-2-ylhex-1-en-2-yl)oxyoxane |
| SMILES | C=C(CC(C)(C(C)C)C(C)(C)C)OC1(C)CCOCC1.O=CO |
| InChI | InChI=1S/C18H34O2.CH2O2/c1-14(2)18(8,16(4,5)6)13-15(3)20-17(7)9-11-19-12-10-17;2-1-3/h14H,3,9-13H2,1-2,4-8H3;1H,(H,2,3) |
| InChIKey | JIFURUDOKVKUKL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|