C20H25NO3 — CID 143526541
1,1-bis(4-methoxyphenyl)-2-[(2R)-pyrrolidin-2-yl]ethanol (PubChem CID 143526541) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 1,1-bis(4-methoxyphenyl)-2-[(2R)-pyrrolidin-2-yl]ethanol.
| Compound Name | 1,1-bis(4-methoxyphenyl)-2-[(2R)-pyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 143526541 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1,1-bis(4-methoxyphenyl)-2-[(2R)-pyrrolidin-2-yl]ethanol |
| SMILES | COc1ccc(C(O)(C[C@H]2CCCN2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H25NO3/c1-23-18-9-5-15(6-10-18)20(22,14-17-4-3-13-21-17)16-7-11-19(24-2)12-8-16/h5-12,17,21-22H,3-4,13-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | DFNNAPSVVJTJFT-QGZVFWFLSA-N |
| XLogP | 3.08 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |