C25H27N3O3 — CID 143526862
ethyl 1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazine-2-carboxylate (PubChem CID 143526862) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is ethyl 1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazine-2-carboxylate.
| Compound Name | ethyl 1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 143526862 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | ethyl 1-(5-methyl-1,2-diphenylpyrrole-3-carbonyl)piperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CNCCN1C(=O)c1cc(C)n(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H27N3O3/c1-3-31-25(30)22-17-26-14-15-27(22)24(29)21-16-18(2)28(20-12-8-5-9-13-20)23(21)19-10-6-4-7-11-19/h4-13,16,22,26H,3,14-15,17H2,1-2H3 |
| InChIKey | MZJBTGCKBGCERE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |