C40H48N4O4 — CID 143526879
tert-butyl 3-benzyl-4-[1-[2-[(3-pentyloxiran-2-yl)amino]phenyl]-2-phenylpyrrole-3-carbonyl]piperazine-1-carboxylate (PubChem CID 143526879) has the molecular formula C40H48N4O4 and a molecular weight of 648.85 g/mol. Its IUPAC name is tert-butyl 3-benzyl-4-[1-[2-[(3-pentyloxiran-2-yl)amino]phenyl]-2-phenylpyrrole-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-benzyl-4-[1-[2-[(3-pentyloxiran-2-yl)amino]phenyl]-2-phenylpyrrole-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143526879 |
| Molecular Formula | C40H48N4O4 |
| Molecular Weight | 648.85 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | tert-butyl 3-benzyl-4-[1-[2-[(3-pentyloxiran-2-yl)amino]phenyl]-2-phenylpyrrole-3-carbonyl]piperazine-1-carboxylate |
| SMILES | CCCCCC1OC1Nc1ccccc1-n1ccc(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2Cc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C40H48N4O4/c1-5-6-9-22-35-37(47-35)41-33-20-14-15-21-34(33)44-24-23-32(36(44)30-18-12-8-13-19-30)38(45)43-26-25-42(39(46)48-40(2,3)4)28-31(43)27-29-16-10-7-11-17-29/h7-8,10-21,23-24,31,35,37,41H,5-6,9,22,25-28H2,1-4H3 |
| InChIKey | RSBDEBITXBYQTR-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.85 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|