C18H22N4S — CID 143526964
4-[4-(dimethylamino)phenyl]-3-(3-ethylphenyl)-1,5-dihydro-1,2,4-triazole-5-thiol (PubChem CID 143526964) has the molecular formula C18H22N4S and a molecular weight of 326.47 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-3-(3-ethylphenyl)-1,5-dihydro-1,2,4-triazole-5-thiol.
| Compound Name | 4-[4-(dimethylamino)phenyl]-3-(3-ethylphenyl)-1,5-dihydro-1,2,4-triazole-5-thiol |
|---|---|
| PubChem CID | 143526964 |
| Molecular Formula | C18H22N4S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-3-(3-ethylphenyl)-1,5-dihydro-1,2,4-triazole-5-thiol |
| SMILES | CCc1cccc(C2=NNC(S)N2c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C18H22N4S/c1-4-13-6-5-7-14(12-13)17-19-20-18(23)22(17)16-10-8-15(9-11-16)21(2)3/h5-12,18,20,23H,4H2,1-3H3 |
| InChIKey | LJJJREHVLPDKBW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|