C27H36F2N6O3 — CID 143527368
9-cyclopentyl-2-[4-[[(3,3-difluorocyclobutyl)amino]-hydroxymethyl]-2-methoxyanilino]-5,7,7-trimethyl-8H-pyrimido[4,5-b][1,4]diazepin-6-one (PubChem CID 143527368) has the molecular formula C27H36F2N6O3 and a molecular weight of 530.62 g/mol. Its IUPAC name is 9-cyclopentyl-2-[4-[[(3,3-difluorocyclobutyl)amino]-hydroxymethyl]-2-methoxyanilino]-5,7,7-trimethyl-8H-pyrimido[4,5-b][1,4]diazepin-6-one.
| Compound Name | 9-cyclopentyl-2-[4-[[(3,3-difluorocyclobutyl)amino]-hydroxymethyl]-2-methoxyanilino]-5,7,7-trimethyl-8H-pyrimido[4,5-b][1,4]diazepin-6-one |
|---|---|
| PubChem CID | 143527368 |
| Molecular Formula | C27H36F2N6O3 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 9-cyclopentyl-2-[4-[[(3,3-difluorocyclobutyl)amino]-hydroxymethyl]-2-methoxyanilino]-5,7,7-trimethyl-8H-pyrimido[4,5-b][1,4]diazepin-6-one |
| SMILES | COc1cc(C(O)NC2CC(F)(F)C2)ccc1Nc1ncc2c(n1)N(C1CCCC1)CC(C)(C)C(=O)N2C |
| InChI | InChI=1S/C27H36F2N6O3/c1-26(2)15-35(18-7-5-6-8-18)22-20(34(3)24(26)37)14-30-25(33-22)32-19-10-9-16(11-21(19)38-4)23(36)31-17-12-27(28,29)13-17/h9-11,14,17-18,23,31,36H,5-8,12-13,15H2,1-4H3,(H,30,32,33) |
| InChIKey | XMDLOLJFEBKRPK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|