About 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine
6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine (PubChem CID 143527795) has the molecular formula C15H18N6O2
and a molecular weight of 314.35 g/mol. Its IUPAC name is 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine.
Molecular Properties
| Compound Name | 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine |
| PubChem CID | 143527795 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine |
| SMILES | CNc1cn2cc(-c3cnc(N)c(OCCOC)n3)ccc2n1 |
| InChI | InChI=1S/C15H18N6O2/c1-17-12-9-21-8-10(3-4-13(21)20-12)11-7-18-14(16)15(19-11)23-6-5-22-2/h3-4,7-9,17H,5-6H2,1-2H3,(H2,16,18) |
| InChIKey | HHDJXORYGUZOLS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine?
The IUPAC name of 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine (CID 143527795) is 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine.
What is the SMILES notation for 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine?
The canonical SMILES for 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine is CNc1cn2cc(-c3cnc(N)c(OCCOC)n3)ccc2n1.
What is the InChIKey of 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine?
The InChIKey is HHDJXORYGUZOLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N6O2/c1-17-12-9-21-8-10(3-4-13(21)20-12)11-7-18-14(16)15(19-11)23-6-5-22-2/h3-4,7-9,17H,5-6H2,1-2H3,(H2,16,18).
What are the key properties of 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine?
6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine has a molecular weight of 314.35 g/mol, XLogP of 1.44, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-amino-6-(2-methoxyethoxy)pyrazin-2-yl]-N-methylimidazo[1,2-a]pyridin-2-amine is sourced from PubChem (CID 143527795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).