C21H26F3N7O2 — CID 143527821
N-[6-[6-amino-5-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-a]pyridin-2-yl]-5-(carbamoylamino)pentanamide;ethane (PubChem CID 143527821) has the molecular formula C21H26F3N7O2 and a molecular weight of 465.48 g/mol. Its IUPAC name is N-[6-[6-amino-5-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-a]pyridin-2-yl]-5-(carbamoylamino)pentanamide;ethane.
| Compound Name | N-[6-[6-amino-5-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-a]pyridin-2-yl]-5-(carbamoylamino)pentanamide;ethane |
|---|---|
| PubChem CID | 143527821 |
| Molecular Formula | C21H26F3N7O2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-[6-[6-amino-5-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-a]pyridin-2-yl]-5-(carbamoylamino)pentanamide;ethane |
| SMILES | CC.NC(=O)NCCCCC(=O)Nc1cn2cc(-c3cnc(N)c(C(F)(F)F)c3)ccc2n1 |
| InChI | InChI=1S/C19H20F3N7O2.C2H6/c20-19(21,22)13-7-12(8-26-17(13)23)11-4-5-15-27-14(10-29(15)9-11)28-16(30)3-1-2-6-25-18(24)31;1-2/h4-5,7-10H,1-3,6H2,(H2,23,26)(H,28,30)(H3,24,25,31);1-2H3 |
| InChIKey | DBKLFLWCNPAYDD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|