About [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine
[(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine (PubChem CID 143527925) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine.
Molecular Properties
| Compound Name | [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine |
| PubChem CID | 143527925 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine |
| SMILES | C=C/C=c1/c(CN)co/c1=C/C |
| InChI | InChI=1S/C10H13NO/c1-3-5-9-8(6-11)7-12-10(9)4-2/h3-5,7H,1,6,11H2,2H3/b9-5-,10-4+ |
| InChIKey | GRQZIBKYTWIXHI-LPTSPAKCSA-N |
| XLogP | 0.51 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine?
The IUPAC name of [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine (CID 143527925) is [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine.
What is the SMILES notation for [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine?
The canonical SMILES for [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine is C=C/C=c1/c(CN)co/c1=C/C.
What is the InChIKey of [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine?
The InChIKey is GRQZIBKYTWIXHI-LPTSPAKCSA-N. The full InChI is InChI=1S/C10H13NO/c1-3-5-9-8(6-11)7-12-10(9)4-2/h3-5,7H,1,6,11H2,2H3/b9-5-,10-4+.
What are the key properties of [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine?
[(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine has a molecular weight of 163.22 g/mol, XLogP of 0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z,5E)-5-ethylidene-4-prop-2-enylidenefuran-3-yl]methanamine is sourced from PubChem (CID 143527925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).