C22H23FIN3O7 — CID 143528453
(3R)-2-[(4R)-4-[4-[(2R)-2,3-dihydroxypropoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-iodophenyl)-3-hydroxybutanamide (PubChem CID 143528453) has the molecular formula C22H23FIN3O7 and a molecular weight of 587.34 g/mol. Its IUPAC name is (3R)-2-[(4R)-4-[4-[(2R)-2,3-dihydroxypropoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-iodophenyl)-3-hydroxybutanamide.
| Compound Name | (3R)-2-[(4R)-4-[4-[(2R)-2,3-dihydroxypropoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-iodophenyl)-3-hydroxybutanamide |
|---|---|
| PubChem CID | 143528453 |
| Molecular Formula | C22H23FIN3O7 |
| Molecular Weight | 587.34 g/mol |
| Exact Mass | 587.06 |
| IUPAC Name | (3R)-2-[(4R)-4-[4-[(2R)-2,3-dihydroxypropoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluoro-4-iodophenyl)-3-hydroxybutanamide |
| SMILES | C[C@@H](O)C(C(=O)Nc1ccc(I)cc1F)N1C(=O)N[C@H](c2ccc(OC[C@H](O)CO)cc2)C1=O |
| InChI | InChI=1S/C22H23FIN3O7/c1-11(29)19(20(31)25-17-7-4-13(24)8-16(17)23)27-21(32)18(26-22(27)33)12-2-5-15(6-3-12)34-10-14(30)9-28/h2-8,11,14,18-19,28-30H,9-10H2,1H3,(H,25,31)(H,26,33)/t11-,14-,18-,19?/m1/s1 |
| InChIKey | AGDCYXKLUABHJI-XSUNQSGOSA-N |
| XLogP | 1.14 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|