C18H32N2 — CID 143528661
N,1-diethyl-N-(4-methylphenyl)piperidin-4-amine;ethane (PubChem CID 143528661) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is N,1-diethyl-N-(4-methylphenyl)piperidin-4-amine;ethane.
| Compound Name | N,1-diethyl-N-(4-methylphenyl)piperidin-4-amine;ethane |
|---|---|
| PubChem CID | 143528661 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | N,1-diethyl-N-(4-methylphenyl)piperidin-4-amine;ethane |
| SMILES | CC.CCN1CCC(N(CC)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C16H26N2.C2H6/c1-4-17-12-10-16(11-13-17)18(5-2)15-8-6-14(3)7-9-15;1-2/h6-9,16H,4-5,10-13H2,1-3H3;1-2H3 |
| InChIKey | GGTJARKJSZLLNB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|