C29H36N4O5 — CID 143528713
(15S)-4-ethoxy-13-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-10-[(3-hydroxyphenyl)methyl]-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 143528713) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is (15S)-4-ethoxy-13-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-10-[(3-hydroxyphenyl)methyl]-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | (15S)-4-ethoxy-13-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-10-[(3-hydroxyphenyl)methyl]-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 143528713 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | (15S)-4-ethoxy-13-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-10-[(3-hydroxyphenyl)methyl]-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | CCOc1ccc2[nH]c3c(c2c1)C[C@@]1(C)C(=O)N(CCN(CC)CCO)C(=O)N1C3Cc1cccc(O)c1 |
| InChI | InChI=1S/C29H36N4O5/c1-4-31(13-14-34)11-12-32-27(36)29(3)18-23-22-17-21(38-5-2)9-10-24(22)30-26(23)25(33(29)28(32)37)16-19-7-6-8-20(35)15-19/h6-10,15,17,25,30,34-35H,4-5,11-14,16,18H2,1-3H3/t25?,29-/m0/s1 |
| InChIKey | JMNJZTROZANMBM-QFCCLOIZSA-N |
| XLogP | 3.45 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|