C30H33FN4O4 — CID 143528756
(15S)-13-[3-(2,5-dihydropyrrol-1-yl)propyl]-4-(1-fluoroethoxy)-10-[(3-hydroxyphenyl)methyl]-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 143528756) has the molecular formula C30H33FN4O4 and a molecular weight of 532.62 g/mol. Its IUPAC name is (15S)-13-[3-(2,5-dihydropyrrol-1-yl)propyl]-4-(1-fluoroethoxy)-10-[(3-hydroxyphenyl)methyl]-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | (15S)-13-[3-(2,5-dihydropyrrol-1-yl)propyl]-4-(1-fluoroethoxy)-10-[(3-hydroxyphenyl)methyl]-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 143528756 |
| Molecular Formula | C30H33FN4O4 |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (15S)-13-[3-(2,5-dihydropyrrol-1-yl)propyl]-4-(1-fluoroethoxy)-10-[(3-hydroxyphenyl)methyl]-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | CC(F)Oc1ccc2[nH]c3c(c2c1)C[C@@]1(C)C(=O)N(CCCN2CC=CC2)C(=O)N1C3Cc1cccc(O)c1 |
| InChI | InChI=1S/C30H33FN4O4/c1-19(31)39-22-9-10-25-23(17-22)24-18-30(2)28(37)34(14-6-13-33-11-3-4-12-33)29(38)35(30)26(27(24)32-25)16-20-7-5-8-21(36)15-20/h3-5,7-10,15,17,19,26,32,36H,6,11-14,16,18H2,1-2H3/t19?,26?,30-/m0/s1 |
| InChIKey | JDZKGLRQJFSQFE-RLNJVETLSA-N |
| XLogP | 4.69 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|