C23H21ClFN3O3 — CID 143528757
(15S)-13-butyl-4-chloro-5-fluoro-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 143528757) has the molecular formula C23H21ClFN3O3 and a molecular weight of 441.89 g/mol. Its IUPAC name is (15S)-13-butyl-4-chloro-5-fluoro-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (15S)-13-butyl-4-chloro-5-fluoro-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 143528757 |
| Molecular Formula | C23H21ClFN3O3 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | (15S)-13-butyl-4-chloro-5-fluoro-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | CCCCN1C(=O)[C@@H]2Cc3c([nH]c4cc(F)c(Cl)cc34)C(c3cccc(O)c3)N2C1=O |
| InChI | InChI=1S/C23H21ClFN3O3/c1-2-3-7-27-22(30)19-10-15-14-9-16(24)17(25)11-18(14)26-20(15)21(28(19)23(27)31)12-5-4-6-13(29)8-12/h4-6,8-9,11,19,21,26,29H,2-3,7,10H2,1H3/t19-,21?/m0/s1 |
| InChIKey | UECBYXUKZHKYLC-ZQRQZVKFSA-N |
| XLogP | 4.74 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|