C27H30ClFN4O3 — CID 143528763
(15S)-4-chloro-5-fluoro-10-[(3-hydroxyphenyl)methyl]-13-[3-[methyl(propan-2-yl)amino]propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 143528763) has the molecular formula C27H30ClFN4O3 and a molecular weight of 513.01 g/mol. Its IUPAC name is (15S)-4-chloro-5-fluoro-10-[(3-hydroxyphenyl)methyl]-13-[3-[methyl(propan-2-yl)amino]propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (15S)-4-chloro-5-fluoro-10-[(3-hydroxyphenyl)methyl]-13-[3-[methyl(propan-2-yl)amino]propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 143528763 |
| Molecular Formula | C27H30ClFN4O3 |
| Molecular Weight | 513.01 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | (15S)-4-chloro-5-fluoro-10-[(3-hydroxyphenyl)methyl]-13-[3-[methyl(propan-2-yl)amino]propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | CC(C)N(C)CCCN1C(=O)[C@@H]2Cc3c([nH]c4cc(F)c(Cl)cc34)C(Cc3cccc(O)c3)N2C1=O |
| InChI | InChI=1S/C27H30ClFN4O3/c1-15(2)31(3)8-5-9-32-26(35)24-13-19-18-12-20(28)21(29)14-22(18)30-25(19)23(33(24)27(32)36)11-16-6-4-7-17(34)10-16/h4,6-7,10,12,14-15,23-24,30,34H,5,8-9,11,13H2,1-3H3/t23?,24-/m0/s1 |
| InChIKey | CZVPWDFCAMFSOM-CGAIIQECSA-N |
| XLogP | 4.87 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.01 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|