C26H26ClFN4O3 — CID 143528870
(15S)-4-chloro-13-[2-(cyclobutylamino)ethyl]-5-fluoro-10-[(3-hydroxyphenyl)methyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 143528870) has the molecular formula C26H26ClFN4O3 and a molecular weight of 496.97 g/mol. Its IUPAC name is (15S)-4-chloro-13-[2-(cyclobutylamino)ethyl]-5-fluoro-10-[(3-hydroxyphenyl)methyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (15S)-4-chloro-13-[2-(cyclobutylamino)ethyl]-5-fluoro-10-[(3-hydroxyphenyl)methyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 143528870 |
| Molecular Formula | C26H26ClFN4O3 |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (15S)-4-chloro-13-[2-(cyclobutylamino)ethyl]-5-fluoro-10-[(3-hydroxyphenyl)methyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | O=C1[C@@H]2Cc3c([nH]c4cc(F)c(Cl)cc34)C(Cc3cccc(O)c3)N2C(=O)N1CCNC1CCC1 |
| InChI | InChI=1S/C26H26ClFN4O3/c27-19-11-17-18-12-23-25(34)31(8-7-29-15-4-2-5-15)26(35)32(23)22(10-14-3-1-6-16(33)9-14)24(18)30-21(17)13-20(19)28/h1,3,6,9,11,13,15,22-23,29-30,33H,2,4-5,7-8,10,12H2/t22?,23-/m0/s1 |
| InChIKey | QTFNIBLEUYTRQP-WCSIJFPASA-N |
| XLogP | 4.28 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|