C18H18F6N4O — CID 143529899
1,2,4-trifluorobenzene;(3S,5R)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]oxan-3-amine (PubChem CID 143529899) has the molecular formula C18H18F6N4O and a molecular weight of 420.36 g/mol. Its IUPAC name is 1,2,4-trifluorobenzene;(3S,5R)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]oxan-3-amine.
| Compound Name | 1,2,4-trifluorobenzene;(3S,5R)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]oxan-3-amine |
|---|---|
| PubChem CID | 143529899 |
| Molecular Formula | C18H18F6N4O |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1,2,4-trifluorobenzene;(3S,5R)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]oxan-3-amine |
| SMILES | Fc1ccc(F)c(F)c1.N[C@@H]1COC[C@H](N2Cc3cnc(C(F)(F)F)nc3C2)C1 |
| InChI | InChI=1S/C12H15F3N4O.C6H3F3/c13-12(14,15)11-17-2-7-3-19(4-10(7)18-11)9-1-8(16)5-20-6-9;7-4-1-2-5(8)6(9)3-4/h2,8-9H,1,3-6,16H2;1-3H/t8-,9+;/m0./s1 |
| InChIKey | MMSPAUGRXUNYQZ-OULXEKPRSA-N |
| XLogP | 3.03 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|