About 4,5-Dipropyl-4-octene
4,5-Dipropyl-4-octene (PubChem CID 143530) has the molecular formula C14H28
and a molecular weight of 196.37 g/mol. Its IUPAC name is 4,5-dipropyloct-4-ene.
Molecular Properties
| Compound Name | 4,5-Dipropyl-4-octene |
| PubChem CID | 143530 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 4,5-dipropyloct-4-ene |
| SMILES | CCCC(=C(CCC)CCC)CCC |
| InChI | InChI=1S/C14H28/c1-5-9-13(10-6-2)14(11-7-3)12-8-4/h5-12H2,1-4H3 |
| InChIKey | JPEJJWOTBXVQJJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | 119 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-Dipropyl-4-octene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-Dipropyl-4-octene?
The IUPAC name of 4,5-Dipropyl-4-octene (CID 143530) is 4,5-dipropyloct-4-ene.
What is the SMILES notation for 4,5-Dipropyl-4-octene?
The canonical SMILES for 4,5-Dipropyl-4-octene is CCCC(=C(CCC)CCC)CCC.
What is the InChIKey of 4,5-Dipropyl-4-octene?
The InChIKey is JPEJJWOTBXVQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28/c1-5-9-13(10-6-2)14(11-7-3)12-8-4/h5-12H2,1-4H3.
What are the key properties of 4,5-Dipropyl-4-octene?
4,5-Dipropyl-4-octene has a molecular weight of 196.37 g/mol, XLogP of 6.80, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-Dipropyl-4-octene is sourced from PubChem (CID 143530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).