About 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine
1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine (PubChem CID 143530000) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine.
Molecular Properties
| Compound Name | 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine |
| PubChem CID | 143530000 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine |
| SMILES | C=CN(N)c1ccc(C)cc1.CN |
| InChI | InChI=1S/C9H12N2.CH5N/c1-3-11(10)9-6-4-8(2)5-7-9;1-2/h3-7H,1,10H2,2H3;2H2,1H3 |
| InChIKey | NQCAXFQUCQSDFU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine?
The IUPAC name of 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine (CID 143530000) is 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine.
What is the SMILES notation for 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine?
The canonical SMILES for 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine is C=CN(N)c1ccc(C)cc1.CN.
What is the InChIKey of 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine?
The InChIKey is NQCAXFQUCQSDFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.CH5N/c1-3-11(10)9-6-4-8(2)5-7-9;1-2/h3-7H,1,10H2,2H3;2H2,1H3.
What are the key properties of 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine?
1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine has a molecular weight of 179.27 g/mol, XLogP of 1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-1-(4-methylphenyl)hydrazine;methanamine is sourced from PubChem (CID 143530000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).