C11H19NOS — CID 143530438
N,N-diethyl-1-(furan-2-yl)-2-methylsulfanylethanamine (PubChem CID 143530438) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is N,N-diethyl-1-(furan-2-yl)-2-methylsulfanylethanamine.
| Compound Name | N,N-diethyl-1-(furan-2-yl)-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 143530438 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N,N-diethyl-1-(furan-2-yl)-2-methylsulfanylethanamine |
| SMILES | CCN(CC)C(CSC)c1ccco1 |
| InChI | InChI=1S/C11H19NOS/c1-4-12(5-2)10(9-14-3)11-7-6-8-13-11/h6-8,10H,4-5,9H2,1-3H3 |
| InChIKey | LVJVIOPBCSRQDY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |