About N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine
N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine (PubChem CID 143531406) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 143531406 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine |
| SMILES | COCCN(C)C1=CC=CCC1 |
| InChI | InChI=1S/C10H17NO/c1-11(8-9-12-2)10-6-4-3-5-7-10/h3-4,6H,5,7-9H2,1-2H3 |
| InChIKey | ANMUDYTYTGYBCE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine?
The IUPAC name of N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine (CID 143531406) is N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine is COCCN(C)C1=CC=CCC1.
What is the InChIKey of N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine?
The InChIKey is ANMUDYTYTGYBCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-11(8-9-12-2)10-6-4-3-5-7-10/h3-4,6H,5,7-9H2,1-2H3.
What are the key properties of N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine?
N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine has a molecular weight of 167.25 g/mol, XLogP of 1.80, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-N-methylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 143531406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).