C18H28N4O3 — CID 143531716
(Z)-3-(2,4-dihydroxyanilino)-N'-[2-(2,6-dimethylmorpholin-4-yl)ethyl]but-2-enimidamide (PubChem CID 143531716) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is (Z)-3-(2,4-dihydroxyanilino)-N'-[2-(2,6-dimethylmorpholin-4-yl)ethyl]but-2-enimidamide.
| Compound Name | (Z)-3-(2,4-dihydroxyanilino)-N'-[2-(2,6-dimethylmorpholin-4-yl)ethyl]but-2-enimidamide |
|---|---|
| PubChem CID | 143531716 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (Z)-3-(2,4-dihydroxyanilino)-N'-[2-(2,6-dimethylmorpholin-4-yl)ethyl]but-2-enimidamide |
| SMILES | C/C(=C/C(N)=N/CCN1CC(C)OC(C)C1)Nc1ccc(O)cc1O |
| InChI | InChI=1S/C18H28N4O3/c1-12(21-16-5-4-15(23)9-17(16)24)8-18(19)20-6-7-22-10-13(2)25-14(3)11-22/h4-5,8-9,13-14,21,23-24H,6-7,10-11H2,1-3H3,(H2,19,20)/b12-8- |
| InChIKey | FYLXORATAVFCHK-WQLSENKSSA-N |
| XLogP | 1.88 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|