C16H22Cl2N4O — CID 143531717
(Z)-3-(2,4-dichloroanilino)-N'-(2-morpholin-4-ylethyl)but-2-enimidamide (PubChem CID 143531717) has the molecular formula C16H22Cl2N4O and a molecular weight of 357.29 g/mol. Its IUPAC name is (Z)-3-(2,4-dichloroanilino)-N'-(2-morpholin-4-ylethyl)but-2-enimidamide.
| Compound Name | (Z)-3-(2,4-dichloroanilino)-N'-(2-morpholin-4-ylethyl)but-2-enimidamide |
|---|---|
| PubChem CID | 143531717 |
| Molecular Formula | C16H22Cl2N4O |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (Z)-3-(2,4-dichloroanilino)-N'-(2-morpholin-4-ylethyl)but-2-enimidamide |
| SMILES | C/C(=C/C(N)=N/CCN1CCOCC1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H22Cl2N4O/c1-12(21-15-3-2-13(17)11-14(15)18)10-16(19)20-4-5-22-6-8-23-9-7-22/h2-3,10-11,21H,4-9H2,1H3,(H2,19,20)/b12-10- |
| InChIKey | NECYJDWBLOUWON-BENRWUELSA-N |
| XLogP | 3.00 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|