C20H32O2 — CID 143532209
1-[(4bR,7S)-7-methoxy-1,2,4b-trimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl]ethanone (PubChem CID 143532209) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 1-[(4bR,7S)-7-methoxy-1,2,4b-trimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl]ethanone.
| Compound Name | 1-[(4bR,7S)-7-methoxy-1,2,4b-trimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl]ethanone |
|---|---|
| PubChem CID | 143532209 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1-[(4bR,7S)-7-methoxy-1,2,4b-trimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl]ethanone |
| SMILES | CO[C@H]1CC[C@@]2(C)C(=CCC3C(C)C(C)(C(C)=O)CCC32)C1 |
| InChI | InChI=1S/C20H32O2/c1-13-17-7-6-15-12-16(22-5)8-10-20(15,4)18(17)9-11-19(13,3)14(2)21/h6,13,16-18H,7-12H2,1-5H3/t13?,16-,17?,18?,19?,20-/m0/s1 |
| InChIKey | IFXGRHBYNNPJOK-GUUVIOSUSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|