C12H13NO2 — CID 143532502
ethyl 1,4-dihydroquinoline-6-carboxylate (PubChem CID 143532502) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is ethyl 1,4-dihydroquinoline-6-carboxylate.
| Compound Name | ethyl 1,4-dihydroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 143532502 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | ethyl 1,4-dihydroquinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)CC=CN2 |
| InChI | InChI=1S/C12H13NO2/c1-2-15-12(14)10-5-6-11-9(8-10)4-3-7-13-11/h3,5-8,13H,2,4H2,1H3 |
| InChIKey | DUARRYURUCVBES-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |