C18H30N2O6 — CID 143532580
[3-methyl-2,4-dioxo-4-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]butyl] 3-hydroxyheptanoate (PubChem CID 143532580) has the molecular formula C18H30N2O6 and a molecular weight of 370.45 g/mol. Its IUPAC name is [3-methyl-2,4-dioxo-4-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]butyl] 3-hydroxyheptanoate.
| Compound Name | [3-methyl-2,4-dioxo-4-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]butyl] 3-hydroxyheptanoate |
|---|---|
| PubChem CID | 143532580 |
| Molecular Formula | C18H30N2O6 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [3-methyl-2,4-dioxo-4-[(2-oxo-2-pyrrolidin-1-ylethyl)amino]butyl] 3-hydroxyheptanoate |
| SMILES | CCCCC(O)CC(=O)OCC(=O)C(C)C(=O)NCC(=O)N1CCCC1 |
| InChI | InChI=1S/C18H30N2O6/c1-3-4-7-14(21)10-17(24)26-12-15(22)13(2)18(25)19-11-16(23)20-8-5-6-9-20/h13-14,21H,3-12H2,1-2H3,(H,19,25) |
| InChIKey | KZHXPWDQHAHYKE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|