About 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane
6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane (PubChem CID 143533128) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane.
Molecular Properties
| Compound Name | 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane |
| PubChem CID | 143533128 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane |
| SMILES | CC.CC1(C)C=Cc2[nH]c(=O)oc2C=C1 |
| InChI | InChI=1S/C10H11NO2.C2H6/c1-10(2)5-3-7-8(4-6-10)13-9(12)11-7;1-2/h3-6H,1-2H3,(H,11,12);1-2H3 |
| InChIKey | NZZNKDZMDRRLJI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane?
The IUPAC name of 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane (CID 143533128) is 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane.
What is the SMILES notation for 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane?
The canonical SMILES for 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane is CC.CC1(C)C=Cc2[nH]c(=O)oc2C=C1.
What is the InChIKey of 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane?
The InChIKey is NZZNKDZMDRRLJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.C2H6/c1-10(2)5-3-7-8(4-6-10)13-9(12)11-7;1-2/h3-6H,1-2H3,(H,11,12);1-2H3.
What are the key properties of 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane?
6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane has a molecular weight of 207.27 g/mol, XLogP of 3.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-3H-cyclohepta[d][1,3]oxazol-2-one;ethane is sourced from PubChem (CID 143533128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).