C19H28N6 — CID 143533319
6-N-(methylideneamino)-4-N,4-N-dipropyl-2-(3-pyridin-2-ylpropyl)pyrimidine-4,6-diamine (PubChem CID 143533319) has the molecular formula C19H28N6 and a molecular weight of 340.48 g/mol. Its IUPAC name is 6-N-(methylideneamino)-4-N,4-N-dipropyl-2-(3-pyridin-2-ylpropyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-(methylideneamino)-4-N,4-N-dipropyl-2-(3-pyridin-2-ylpropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 143533319 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 6-N-(methylideneamino)-4-N,4-N-dipropyl-2-(3-pyridin-2-ylpropyl)pyrimidine-4,6-diamine |
| SMILES | C=NNc1cc(N(CCC)CCC)nc(CCCc2ccccn2)n1 |
| InChI | InChI=1S/C19H28N6/c1-4-13-25(14-5-2)19-15-18(24-20-3)22-17(23-19)11-8-10-16-9-6-7-12-21-16/h6-7,9,12,15H,3-5,8,10-11,13-14H2,1-2H3,(H,22,23,24) |
| InChIKey | VEPKZRANVPFLBQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|