C24H33N7O2 — CID 143533349
4-[(2E)-2-[[4-(dipropylamino)-6-[(3Z,5Z)-3-(methylideneamino)hepta-3,5-dienoxy]-1,3,5-triazin-2-yl]methylidene]hydrazinyl]phenol (PubChem CID 143533349) has the molecular formula C24H33N7O2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 4-[(2E)-2-[[4-(dipropylamino)-6-[(3Z,5Z)-3-(methylideneamino)hepta-3,5-dienoxy]-1,3,5-triazin-2-yl]methylidene]hydrazinyl]phenol.
| Compound Name | 4-[(2E)-2-[[4-(dipropylamino)-6-[(3Z,5Z)-3-(methylideneamino)hepta-3,5-dienoxy]-1,3,5-triazin-2-yl]methylidene]hydrazinyl]phenol |
|---|---|
| PubChem CID | 143533349 |
| Molecular Formula | C24H33N7O2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 4-[(2E)-2-[[4-(dipropylamino)-6-[(3Z,5Z)-3-(methylideneamino)hepta-3,5-dienoxy]-1,3,5-triazin-2-yl]methylidene]hydrazinyl]phenol |
| SMILES | C=N/C(=C\C=C/C)CCOc1nc(/C=N/Nc2ccc(O)cc2)nc(N(CCC)CCC)n1 |
| InChI | InChI=1S/C24H33N7O2/c1-5-8-9-19(25-4)14-17-33-24-28-22(18-26-30-20-10-12-21(32)13-11-20)27-23(29-24)31(15-6-2)16-7-3/h5,8-13,18,30,32H,4,6-7,14-17H2,1-3H3/b8-5-,19-9-,26-18+ |
| InChIKey | SEPOYJINHIKDOU-DVBWSZGXSA-N |
| XLogP | 4.58 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|