C22H35F3N2OS — CID 143533921
1-methyl-3-(5-methylthiophen-2-yl)-5-(trifluoromethyl)pyrazole;nonan-1-ol;prop-1-ene (PubChem CID 143533921) has the molecular formula C22H35F3N2OS and a molecular weight of 432.60 g/mol. Its IUPAC name is 1-methyl-3-(5-methylthiophen-2-yl)-5-(trifluoromethyl)pyrazole;nonan-1-ol;prop-1-ene.
| Compound Name | 1-methyl-3-(5-methylthiophen-2-yl)-5-(trifluoromethyl)pyrazole;nonan-1-ol;prop-1-ene |
|---|---|
| PubChem CID | 143533921 |
| Molecular Formula | C22H35F3N2OS |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 1-methyl-3-(5-methylthiophen-2-yl)-5-(trifluoromethyl)pyrazole;nonan-1-ol;prop-1-ene |
| SMILES | C=CC.CCCCCCCCCO.Cc1ccc(-c2cc(C(F)(F)F)n(C)n2)s1 |
| InChI | InChI=1S/C10H9F3N2S.C9H20O.C3H6/c1-6-3-4-8(16-6)7-5-9(10(11,12)13)15(2)14-7;1-2-3-4-5-6-7-8-9-10;1-3-2/h3-5H,1-2H3;10H,2-9H2,1H3;3H,1H2,2H3 |
| InChIKey | ADIUIVIETGRBOL-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|