C15H18F3N3O — CID 143534021
N,N-dimethyl-3-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzamide;ethane (PubChem CID 143534021) has the molecular formula C15H18F3N3O and a molecular weight of 313.32 g/mol. Its IUPAC name is N,N-dimethyl-3-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzamide;ethane.
| Compound Name | N,N-dimethyl-3-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzamide;ethane |
|---|---|
| PubChem CID | 143534021 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N,N-dimethyl-3-[5-(trifluoromethyl)-1H-pyrazol-3-yl]benzamide;ethane |
| SMILES | CC.CN(C)C(=O)c1cccc(-c2cc(C(F)(F)F)[nH]n2)c1 |
| InChI | InChI=1S/C13H12F3N3O.C2H6/c1-19(2)12(20)9-5-3-4-8(6-9)10-7-11(18-17-10)13(14,15)16;1-2/h3-7H,1-2H3,(H,17,18);1-2H3 |
| InChIKey | IYGURCBPVLORKQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |