C19H27F5N3OP — CID 143534067
6-[(E)-7,7-difluoro-6-methylimino-7-phosphanylhept-2-en-2-yl]-N,N-dimethylpyridine-2-carboxamide;1,1,1-trifluoropropane (PubChem CID 143534067) has the molecular formula C19H27F5N3OP and a molecular weight of 439.41 g/mol. Its IUPAC name is 6-[(E)-7,7-difluoro-6-methylimino-7-phosphanylhept-2-en-2-yl]-N,N-dimethylpyridine-2-carboxamide;1,1,1-trifluoropropane.
| Compound Name | 6-[(E)-7,7-difluoro-6-methylimino-7-phosphanylhept-2-en-2-yl]-N,N-dimethylpyridine-2-carboxamide;1,1,1-trifluoropropane |
|---|---|
| PubChem CID | 143534067 |
| Molecular Formula | C19H27F5N3OP |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 6-[(E)-7,7-difluoro-6-methylimino-7-phosphanylhept-2-en-2-yl]-N,N-dimethylpyridine-2-carboxamide;1,1,1-trifluoropropane |
| SMILES | C/N=C(\CC/C=C(\C)c1cccc(C(=O)N(C)C)n1)C(F)(F)P.CCC(F)(F)F |
| InChI | InChI=1S/C16H22F2N3OP.C3H5F3/c1-11(7-5-10-14(19-2)16(17,18)23)12-8-6-9-13(20-12)15(22)21(3)4;1-2-3(4,5)6/h6-9H,5,10,23H2,1-4H3;2H2,1H3/b11-7+,19-14+; |
| InChIKey | HSOJXWRKLAFJHB-ZLQRNGCESA-N |
| XLogP | 5.46 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|