About 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone
1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone (PubChem CID 143534587) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone.
Molecular Properties
| Compound Name | 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone |
| PubChem CID | 143534587 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCN(CC2=CCCC=N2)CC1 |
| InChI | InChI=1S/C13H21N3O2/c1-18-11-13(17)16-8-6-15(7-9-16)10-12-4-2-3-5-14-12/h4-5H,2-3,6-11H2,1H3 |
| InChIKey | UXJKCBKQNZQWFO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone?
The IUPAC name of 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone (CID 143534587) is 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone.
What is the SMILES notation for 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone?
The canonical SMILES for 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone is COCC(=O)N1CCN(CC2=CCCC=N2)CC1.
What is the InChIKey of 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone?
The InChIKey is UXJKCBKQNZQWFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-18-11-13(17)16-8-6-15(7-9-16)10-12-4-2-3-5-14-12/h4-5H,2-3,6-11H2,1H3.
What are the key properties of 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone?
1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone has a molecular weight of 251.33 g/mol, XLogP of 0.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,4-dihydropyridin-6-ylmethyl)piperazin-1-yl]-2-methoxyethanone is sourced from PubChem (CID 143534587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).