About (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane
(3Z)-5-aminohexa-1,3,5-trien-2-ol;methane (PubChem CID 143535051) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane.
Molecular Properties
| Compound Name | (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane |
| PubChem CID | 143535051 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane |
| SMILES | C.C=C(N)/C=C\C(=C)O |
| InChI | InChI=1S/C6H9NO.CH4/c1-5(7)3-4-6(2)8;/h3-4,8H,1-2,7H2;1H4/b4-3-; |
| InChIKey | JFLKKPGFYGHARS-LNKPDPKZSA-N |
| XLogP | 1.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane?
The IUPAC name of (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane (CID 143535051) is (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane.
What is the SMILES notation for (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane?
The canonical SMILES for (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane is C.C=C(N)/C=C\C(=C)O.
What is the InChIKey of (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane?
The InChIKey is JFLKKPGFYGHARS-LNKPDPKZSA-N. The full InChI is InChI=1S/C6H9NO.CH4/c1-5(7)3-4-6(2)8;/h3-4,8H,1-2,7H2;1H4/b4-3-;.
What are the key properties of (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane?
(3Z)-5-aminohexa-1,3,5-trien-2-ol;methane has a molecular weight of 127.19 g/mol, XLogP of 1.72, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-aminohexa-1,3,5-trien-2-ol;methane is sourced from PubChem (CID 143535051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).