About [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol
[2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol (PubChem CID 143535272) has the molecular formula C17H22N2O2S
and a molecular weight of 318.44 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol |
| PubChem CID | 143535272 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol |
| SMILES | Cc1ccc(-c2nc(CN3CCOCC3)c(CO)s2)cc1C |
| InChI | InChI=1S/C17H22N2O2S/c1-12-3-4-14(9-13(12)2)17-18-15(16(11-20)22-17)10-19-5-7-21-8-6-19/h3-4,9,20H,5-8,10-11H2,1-2H3 |
| InChIKey | PUVMILJBGOUYFV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol (CID 143535272) is [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol is Cc1ccc(-c2nc(CN3CCOCC3)c(CO)s2)cc1C.
What is the InChIKey of [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol?
The InChIKey is PUVMILJBGOUYFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2S/c1-12-3-4-14(9-13(12)2)17-18-15(16(11-20)22-17)10-19-5-7-21-8-6-19/h3-4,9,20H,5-8,10-11H2,1-2H3.
What are the key properties of [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol?
[2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol has a molecular weight of 318.44 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethylphenyl)-4-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 143535272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).