C20H22 — CID 143535689
5,5,8,11,11-pentamethyl-9H-cyclohepta[b]naphthalene (PubChem CID 143535689) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is 5,5,8,11,11-pentamethyl-9H-cyclohepta[b]naphthalene.
| Compound Name | 5,5,8,11,11-pentamethyl-9H-cyclohepta[b]naphthalene |
|---|---|
| PubChem CID | 143535689 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 5,5,8,11,11-pentamethyl-9H-cyclohepta[b]naphthalene |
| SMILES | CC1=CC=C2C(=CC1)C(C)(C)C1=C(C=C=C=C1)C2(C)C |
| InChI | InChI=1S/C20H22/c1-14-10-12-17-18(13-11-14)20(4,5)16-9-7-6-8-15(16)19(17,2)3/h8-10,12-13H,11H2,1-5H3 |
| InChIKey | BJWSORWRRHIMCT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |