About 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete
1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete (PubChem CID 143535983) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete.
Molecular Properties
| Compound Name | 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete |
| PubChem CID | 143535983 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete |
| SMILES | Cc1ccc(OCCCCN2C=NC2)cc1 |
| InChI | InChI=1S/C13H18N2O/c1-12-4-6-13(7-5-12)16-9-3-2-8-15-10-14-11-15/h4-7,10H,2-3,8-9,11H2,1H3 |
| InChIKey | QVGAVCIWTYCWIE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete?
The IUPAC name of 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete (CID 143535983) is 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete.
What is the SMILES notation for 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete?
The canonical SMILES for 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete is Cc1ccc(OCCCCN2C=NC2)cc1.
What is the InChIKey of 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete?
The InChIKey is QVGAVCIWTYCWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-12-4-6-13(7-5-12)16-9-3-2-8-15-10-14-11-15/h4-7,10H,2-3,8-9,11H2,1H3.
What are the key properties of 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete?
1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete has a molecular weight of 218.30 g/mol, XLogP of 2.46, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-methylphenoxy)butyl]-2H-1,3-diazete is sourced from PubChem (CID 143535983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).