C17H23NO4 — CID 143536259
4a-ethyl-5,6,10a-trihydroxy-10-(methylamino)-2,4,9,10-tetrahydro-1H-phenanthren-3-one (PubChem CID 143536259) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 4a-ethyl-5,6,10a-trihydroxy-10-(methylamino)-2,4,9,10-tetrahydro-1H-phenanthren-3-one.
| Compound Name | 4a-ethyl-5,6,10a-trihydroxy-10-(methylamino)-2,4,9,10-tetrahydro-1H-phenanthren-3-one |
|---|---|
| PubChem CID | 143536259 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 4a-ethyl-5,6,10a-trihydroxy-10-(methylamino)-2,4,9,10-tetrahydro-1H-phenanthren-3-one |
| SMILES | CCC12CC(=O)CCC1(O)C(NC)Cc1ccc(O)c(O)c12 |
| InChI | InChI=1S/C17H23NO4/c1-3-16-9-11(19)6-7-17(16,22)13(18-2)8-10-4-5-12(20)15(21)14(10)16/h4-5,13,18,20-22H,3,6-9H2,1-2H3 |
| InChIKey | BXZYORISIJGFCS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|