C15H17N3O2 — CID 143536580
N-methyl-3-oxo-2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]pyridazine-4-carboxamide (PubChem CID 143536580) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-methyl-3-oxo-2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]pyridazine-4-carboxamide.
| Compound Name | N-methyl-3-oxo-2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 143536580 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-methyl-3-oxo-2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]pyridazine-4-carboxamide |
| SMILES | C=C/C=C\C(=C/C=C)Cn1nccc(C(=O)NC)c1=O |
| InChI | InChI=1S/C15H17N3O2/c1-4-6-8-12(7-5-2)11-18-15(20)13(9-10-17-18)14(19)16-3/h4-10H,1-2,11H2,3H3,(H,16,19)/b8-6-,12-7+ |
| InChIKey | QYUKZQPGRLDDSJ-LQNKLOEDSA-N |
| XLogP | 1.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|