About (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane
(1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane (PubChem CID 143536598) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane.
Molecular Properties
| Compound Name | (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane |
| PubChem CID | 143536598 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane |
| SMILES | C/C=C\C=C1\CCCCC\C1=C\C.CC |
| InChI | InChI=1S/C13H20.C2H6/c1-3-5-9-13-11-8-6-7-10-12(13)4-2;1-2/h3-5,9H,6-8,10-11H2,1-2H3;1-2H3/b5-3-,12-4-,13-9-; |
| InChIKey | QWHXMTGCVJCWLE-UVOAWLNHSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane?
The IUPAC name of (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane (CID 143536598) is (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane.
What is the SMILES notation for (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane?
The canonical SMILES for (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane is C/C=C\C=C1\CCCCC\C1=C\C.CC.
What is the InChIKey of (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane?
The InChIKey is QWHXMTGCVJCWLE-UVOAWLNHSA-N. The full InChI is InChI=1S/C13H20.C2H6/c1-3-5-9-13-11-8-6-7-10-12(13)4-2;1-2/h3-5,9H,6-8,10-11H2,1-2H3;1-2H3/b5-3-,12-4-,13-9-;.
What are the key properties of (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane?
(1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane has a molecular weight of 206.37 g/mol, XLogP of 5.43, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,2Z)-1-[(Z)-but-2-enylidene]-2-ethylidenecycloheptane;ethane is sourced from PubChem (CID 143536598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).