C29H31N3O4S — CID 143537020
N-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-yl]-N-(4-pentoxy-3-prop-1-en-2-ylphenyl)cyclopropanecarboxamide (PubChem CID 143537020) has the molecular formula C29H31N3O4S and a molecular weight of 517.65 g/mol. Its IUPAC name is N-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-yl]-N-(4-pentoxy-3-prop-1-en-2-ylphenyl)cyclopropanecarboxamide.
| Compound Name | N-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-yl]-N-(4-pentoxy-3-prop-1-en-2-ylphenyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 143537020 |
| Molecular Formula | C29H31N3O4S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-yl]-N-(4-pentoxy-3-prop-1-en-2-ylphenyl)cyclopropanecarboxamide |
| SMILES | C=C(C)c1cc(N(C(=O)C2CC2)c2nc(-c3ccc4c(c3)NC(=O)CO4)cs2)ccc1OCCCCC |
| InChI | InChI=1S/C29H31N3O4S/c1-4-5-6-13-35-25-12-10-21(15-22(25)18(2)3)32(28(34)19-7-8-19)29-31-24(17-37-29)20-9-11-26-23(14-20)30-27(33)16-36-26/h9-12,14-15,17,19H,2,4-8,13,16H2,1,3H3,(H,30,33) |
| InChIKey | AWIJOGXLDOFNKV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|