About 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol
2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol (PubChem CID 143537795) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol |
| PubChem CID | 143537795 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol |
| SMILES | C/C=C\C=C1\CCCC(NCCO)\C1=C\C |
| InChI | InChI=1S/C14H23NO/c1-3-5-7-12-8-6-9-14(13(12)4-2)15-10-11-16/h3-5,7,14-16H,6,8-11H2,1-2H3/b5-3-,12-7-,13-4+ |
| InChIKey | ZMRYRMOQPKPAKQ-WXYTZCEMSA-N |
| XLogP | 2.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol?
The IUPAC name of 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol (CID 143537795) is 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol.
What is the SMILES notation for 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol?
The canonical SMILES for 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol is C/C=C\C=C1\CCCC(NCCO)\C1=C\C.
What is the InChIKey of 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol?
The InChIKey is ZMRYRMOQPKPAKQ-WXYTZCEMSA-N. The full InChI is InChI=1S/C14H23NO/c1-3-5-7-12-8-6-9-14(13(12)4-2)15-10-11-16/h3-5,7,14-16H,6,8-11H2,1-2H3/b5-3-,12-7-,13-4+.
What are the key properties of 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol?
2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol has a molecular weight of 221.34 g/mol, XLogP of 2.57, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2E,3Z)-3-[(Z)-but-2-enylidene]-2-ethylidenecyclohexyl]amino]ethanol is sourced from PubChem (CID 143537795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).