About ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine
ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine (PubChem CID 143538747) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine |
| PubChem CID | 143538747 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine |
| SMILES | C=C/C=C(\C=C)CN(C)C.CC |
| InChI | InChI=1S/C9H15N.C2H6/c1-5-7-9(6-2)8-10(3)4;1-2/h5-7H,1-2,8H2,3-4H3;1-2H3/b9-7+; |
| InChIKey | KDOWUXWTBCTONL-BXTVWIJMSA-N |
| XLogP | 2.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine?
The IUPAC name of ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine (CID 143538747) is ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine.
What is the SMILES notation for ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine?
The canonical SMILES for ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine is C=C/C=C(\C=C)CN(C)C.CC.
What is the InChIKey of ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine?
The InChIKey is KDOWUXWTBCTONL-BXTVWIJMSA-N. The full InChI is InChI=1S/C9H15N.C2H6/c1-5-7-9(6-2)8-10(3)4;1-2/h5-7H,1-2,8H2,3-4H3;1-2H3/b9-7+;.
What are the key properties of ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine?
ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine has a molecular weight of 167.30 g/mol, XLogP of 2.87, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E)-2-ethenyl-N,N-dimethylpenta-2,4-dien-1-amine is sourced from PubChem (CID 143538747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).