C19H20N4OS2 — CID 143538859
4-(2,4-dimethylphenyl)-2-methylsulfanyl-7-(2-sulfanylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 143538859) has the molecular formula C19H20N4OS2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-2-methylsulfanyl-7-(2-sulfanylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile.
| Compound Name | 4-(2,4-dimethylphenyl)-2-methylsulfanyl-7-(2-sulfanylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 143538859 |
| Molecular Formula | C19H20N4OS2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-2-methylsulfanyl-7-(2-sulfanylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(C)cc2C)c2c(C#N)cn(COCCS)c2n1 |
| InChI | InChI=1S/C19H20N4OS2/c1-12-4-5-15(13(2)8-12)17-16-14(9-20)10-23(11-24-6-7-25)18(16)22-19(21-17)26-3/h4-5,8,10,25H,6-7,11H2,1-3H3 |
| InChIKey | WSSQIIIDWUFHBX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|