About N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane
N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane (PubChem CID 143539231) has the molecular formula C18H27N5
and a molecular weight of 313.45 g/mol. Its IUPAC name is N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane.
Molecular Properties
| Compound Name | N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane |
| PubChem CID | 143539231 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane |
| SMILES | C.CN(Cc1cc(C(C)(C)C#N)cc(C(C)(C)C#N)c1)/N=C\N |
| InChI | InChI=1S/C17H23N5.CH4/c1-16(2,10-18)14-6-13(9-22(5)21-12-20)7-15(8-14)17(3,4)11-19;/h6-8,12H,9H2,1-5H3,(H2,20,21);1H4 |
| InChIKey | ZGWJAJKXGINNEX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane?
The IUPAC name of N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane (CID 143539231) is N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane.
What is the SMILES notation for N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane?
The canonical SMILES for N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane is C.CN(Cc1cc(C(C)(C)C#N)cc(C(C)(C)C#N)c1)/N=C\N.
What is the InChIKey of N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane?
The InChIKey is ZGWJAJKXGINNEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5.CH4/c1-16(2,10-18)14-6-13(9-22(5)21-12-20)7-15(8-14)17(3,4)11-19;/h6-8,12H,9H2,1-5H3,(H2,20,21);1H4.
What are the key properties of N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane?
N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane has a molecular weight of 313.45 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[3,5-bis(2-cyanopropan-2-yl)phenyl]methyl-methylamino]methanimidamide;methane is sourced from PubChem (CID 143539231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).