About 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene
5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene (PubChem CID 143539268) has the molecular formula C19H24
and a molecular weight of 252.40 g/mol. Its IUPAC name is 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene |
| PubChem CID | 143539268 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene |
| SMILES | C#CC(C)C(C)(CC)c1c(C)ccc2c1C=CCC2 |
| InChI | InChI=1S/C19H24/c1-6-15(4)19(5,7-2)18-14(3)12-13-16-10-8-9-11-17(16)18/h1,9,11-13,15H,7-8,10H2,2-5H3 |
| InChIKey | FLQMIGLHEKCROW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene?
The IUPAC name of 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene (CID 143539268) is 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene.
What is the SMILES notation for 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene?
The canonical SMILES for 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene is C#CC(C)C(C)(CC)c1c(C)ccc2c1C=CCC2.
What is the InChIKey of 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene?
The InChIKey is FLQMIGLHEKCROW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24/c1-6-15(4)19(5,7-2)18-14(3)12-13-16-10-8-9-11-17(16)18/h1,9,11-13,15H,7-8,10H2,2-5H3.
What are the key properties of 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene?
5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene has a molecular weight of 252.40 g/mol, XLogP of 4.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethylhex-5-yn-3-yl)-6-methyl-1,2-dihydronaphthalene is sourced from PubChem (CID 143539268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).