About 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione
7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione (PubChem CID 143539357) has the molecular formula C8H10N2S
and a molecular weight of 166.25 g/mol. Its IUPAC name is 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione.
Molecular Properties
| Compound Name | 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione |
| PubChem CID | 143539357 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione |
| SMILES | CC12C=CC=CC1NC(=S)N2 |
| InChI | InChI=1S/C8H10N2S/c1-8-5-3-2-4-6(8)9-7(11)10-8/h2-6H,1H3,(H2,9,10,11) |
| InChIKey | PWLMONVHQUTMJK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione?
The IUPAC name of 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione (CID 143539357) is 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione.
What is the SMILES notation for 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione?
The canonical SMILES for 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione is CC12C=CC=CC1NC(=S)N2.
What is the InChIKey of 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione?
The InChIKey is PWLMONVHQUTMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S/c1-8-5-3-2-4-6(8)9-7(11)10-8/h2-6H,1H3,(H2,9,10,11).
What are the key properties of 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione?
7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione has a molecular weight of 166.25 g/mol, XLogP of 0.72, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7a-methyl-3,3a-dihydro-1H-benzimidazole-2-thione is sourced from PubChem (CID 143539357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).