About 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane
3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane (PubChem CID 143539564) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane.
Molecular Properties
| Compound Name | 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane |
| PubChem CID | 143539564 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane |
| SMILES | CC.CCCCc1nnc(C2CCC2)n1C1CC1 |
| InChI | InChI=1S/C13H21N3.C2H6/c1-2-3-7-12-14-15-13(10-5-4-6-10)16(12)11-8-9-11;1-2/h10-11H,2-9H2,1H3;1-2H3 |
| InChIKey | AXEHZMPVXVCDOO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane?
The IUPAC name of 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane (CID 143539564) is 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane.
What is the SMILES notation for 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane?
The canonical SMILES for 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane is CC.CCCCc1nnc(C2CCC2)n1C1CC1.
What is the InChIKey of 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane?
The InChIKey is AXEHZMPVXVCDOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3.C2H6/c1-2-3-7-12-14-15-13(10-5-4-6-10)16(12)11-8-9-11;1-2/h10-11H,2-9H2,1H3;1-2H3.
What are the key properties of 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane?
3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane has a molecular weight of 249.40 g/mol, XLogP of 4.25, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-5-cyclobutyl-4-cyclopropyl-1,2,4-triazole;ethane is sourced from PubChem (CID 143539564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).