C25H31FN2O3 — CID 143539625
7-(4-fluoro-2-methoxyphenyl)-1,3,3-trimethyl-8-(4-methylpenta-1,3-dien-3-yloxymethyl)-4H-quinoxalin-2-one;molecular hydrogen (PubChem CID 143539625) has the molecular formula C25H31FN2O3 and a molecular weight of 426.53 g/mol. Its IUPAC name is 7-(4-fluoro-2-methoxyphenyl)-1,3,3-trimethyl-8-(4-methylpenta-1,3-dien-3-yloxymethyl)-4H-quinoxalin-2-one;molecular hydrogen.
| Compound Name | 7-(4-fluoro-2-methoxyphenyl)-1,3,3-trimethyl-8-(4-methylpenta-1,3-dien-3-yloxymethyl)-4H-quinoxalin-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 143539625 |
| Molecular Formula | C25H31FN2O3 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 7-(4-fluoro-2-methoxyphenyl)-1,3,3-trimethyl-8-(4-methylpenta-1,3-dien-3-yloxymethyl)-4H-quinoxalin-2-one;molecular hydrogen |
| SMILES | C=CC(OCc1c(-c2ccc(F)cc2OC)ccc2c1N(C)C(=O)C(C)(C)N2)=C(C)C.[H][H] |
| InChI | InChI=1S/C25H29FN2O3.H2/c1-8-21(15(2)3)31-14-19-17(18-10-9-16(26)13-22(18)30-7)11-12-20-23(19)28(6)24(29)25(4,5)27-20;/h8-13,27H,1,14H2,2-7H3;1H |
| InChIKey | VOWFLUPZBNFWBX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|